C21H34F2O5 — CID 18606106
methyl (5Z)-5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R,4S)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 18606106) has the molecular formula C21H34F2O5 and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl (5Z)-5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R,4S)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | methyl (5Z)-5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R,4S)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 18606106 |
| Molecular Formula | C21H34F2O5 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | methyl (5Z)-5-[(3S,3aR,4R,5R,6aR)-3-fluoro-4-[(3R,4S)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCCC[C@H](F)[C@H](O)CC[C@@H]1[C@H]2[C@H](F)/C(=C/CCCC(=O)OC)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C21H34F2O5/c1-3-4-7-14(22)15(24)11-10-13-16(25)12-18-20(13)21(23)17(28-18)8-5-6-9-19(26)27-2/h8,13-16,18,20-21,24-25H,3-7,9-12H2,1-2H3/b17-8-/t13-,14-,15+,16+,18+,20+,21+/m0/s1 |
| InChIKey | LRLSCUYNKIJYSX-JIILUTDWSA-N |
| XLogP | 3.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|