C25H38O8 — CID 18606528
[(3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] oxolane-2-carboxylate (PubChem CID 18606528) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is [(3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] oxolane-2-carboxylate.
| Compound Name | [(3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 18606528 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [(3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] oxolane-2-carboxylate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3C(OC(=O)C3CCCO3)[C@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C25H38O8/c1-7-22(4)13-16(27)25(30)23(5)15(26)10-11-21(2,3)18(23)17(19(28)24(25,6)33-22)32-20(29)14-9-8-12-31-14/h7,14-15,17-19,26,28,30H,1,8-13H2,2-6H3/t14?,15-,17?,18-,19-,22-,23-,24+,25-/m0/s1 |
| InChIKey | LEYGLNPZPAQNPO-UPCIKOEXSA-N |
| XLogP | 1.68 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|