C28H38O5 — CID 18606795
(4R,6'S,8'S,10'R,13'S,14'S)-2-(3-ethoxypropyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione (PubChem CID 18606795) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (4R,6'S,8'S,10'R,13'S,14'S)-2-(3-ethoxypropyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione.
| Compound Name | (4R,6'S,8'S,10'R,13'S,14'S)-2-(3-ethoxypropyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione |
|---|---|
| PubChem CID | 18606795 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (4R,6'S,8'S,10'R,13'S,14'S)-2-(3-ethoxypropyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione |
| SMILES | CCOCCCC1OCC(=O)[C@]2(CC[C@H]3[C@@H]4C[C@H](C)C5=CC(=O)C=C[C@]5(C)C4=CC[C@@]32C)O1 |
| InChI | InChI=1S/C28H38O5/c1-5-31-14-6-7-25-32-17-24(30)28(33-25)13-10-22-20-15-18(2)23-16-19(29)8-11-26(23,3)21(20)9-12-27(22,28)4/h8-9,11,16,18,20,22,25H,5-7,10,12-15,17H2,1-4H3/t18-,20+,22-,25?,26+,27-,28-/m0/s1 |
| InChIKey | BIDMBBJPRMOCQZ-PKZPOHKPSA-N |
| XLogP | 4.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|