C27H36O5 — CID 18606796
(4R,6'S,8'S,10'R,13'S,14'S)-2-(2-ethoxyethyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione (PubChem CID 18606796) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is (4R,6'S,8'S,10'R,13'S,14'S)-2-(2-ethoxyethyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione.
| Compound Name | (4R,6'S,8'S,10'R,13'S,14'S)-2-(2-ethoxyethyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione |
|---|---|
| PubChem CID | 18606796 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (4R,6'S,8'S,10'R,13'S,14'S)-2-(2-ethoxyethyl)-6',10',13'-trimethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-3',5-dione |
| SMILES | CCOCCC1OCC(=O)[C@]2(CC[C@H]3[C@@H]4C[C@H](C)C5=CC(=O)C=C[C@]5(C)C4=CC[C@@]32C)O1 |
| InChI | InChI=1S/C27H36O5/c1-5-30-13-9-24-31-16-23(29)27(32-24)12-8-21-19-14-17(2)22-15-18(28)6-10-25(22,3)20(19)7-11-26(21,27)4/h6-7,10,15,17,19,21,24H,5,8-9,11-14,16H2,1-4H3/t17-,19+,21-,24?,25+,26-,27-/m0/s1 |
| InChIKey | VVXYKMSEEYWKBD-ATCBAOFWSA-N |
| XLogP | 4.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|