C29H47NO3S2 — CID 18607120
N-benzyl-5-[[(1R,2R,3S,4S)-3-(4-hexan-3-ylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxypentanamide (PubChem CID 18607120) has the molecular formula C29H47NO3S2 and a molecular weight of 521.83 g/mol. Its IUPAC name is N-benzyl-5-[[(1R,2R,3S,4S)-3-(4-hexan-3-ylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxypentanamide.
| Compound Name | N-benzyl-5-[[(1R,2R,3S,4S)-3-(4-hexan-3-ylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 18607120 |
| Molecular Formula | C29H47NO3S2 |
| Molecular Weight | 521.83 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | N-benzyl-5-[[(1R,2R,3S,4S)-3-(4-hexan-3-ylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxypentanamide |
| SMILES | CCCC(CC)SCCCC[C@H]1[C@@H](CSCCCCC(=O)N(O)Cc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C29H47NO3S2/c1-3-12-24(4-2)35-20-11-8-15-25-26(28-18-17-27(25)33-28)22-34-19-10-9-16-29(31)30(32)21-23-13-6-5-7-14-23/h5-7,13-14,24-28,32H,3-4,8-12,15-22H2,1-2H3/t24?,25-,26+,27-,28+/m0/s1 |
| InChIKey | WJJJRSPBNUMERT-GOEGALCDSA-N |
| XLogP | 7.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.83 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|