C12H20O6 — CID 18607164
(2R)-2-[(1S,2S)-2-[(1R)-1,2-dihydroxyethyl]-1,2-dihydroxy-3,3-dimethylcyclopropyl]-2-hydroxy-3,3-dimethylcyclopropan-1-one (PubChem CID 18607164) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2R)-2-[(1S,2S)-2-[(1R)-1,2-dihydroxyethyl]-1,2-dihydroxy-3,3-dimethylcyclopropyl]-2-hydroxy-3,3-dimethylcyclopropan-1-one.
| Compound Name | (2R)-2-[(1S,2S)-2-[(1R)-1,2-dihydroxyethyl]-1,2-dihydroxy-3,3-dimethylcyclopropyl]-2-hydroxy-3,3-dimethylcyclopropan-1-one |
|---|---|
| PubChem CID | 18607164 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2R)-2-[(1S,2S)-2-[(1R)-1,2-dihydroxyethyl]-1,2-dihydroxy-3,3-dimethylcyclopropyl]-2-hydroxy-3,3-dimethylcyclopropan-1-one |
| SMILES | CC1(C)C(=O)[C@]1(O)[C@]1(O)C(C)(C)[C@]1(O)[C@H](O)CO |
| InChI | InChI=1S/C12H20O6/c1-8(2)7(15)11(8,17)12(18)9(3,4)10(12,16)6(14)5-13/h6,13-14,16-18H,5H2,1-4H3/t6-,10-,11-,12+/m1/s1 |
| InChIKey | MIWUIQJIYIKEFP-ZNHSANFISA-N |
| XLogP | -1.82 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |