About 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid
1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid (PubChem CID 18607513) has the molecular formula C27H48O2
and a molecular weight of 404.68 g/mol. Its IUPAC name is 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid |
| PubChem CID | 18607513 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCC1(C2CCCCC2)CCC(CCCC)(C2(C(=O)O)CCCCC2)CC1 |
| InChI | InChI=1S/C27H48O2/c1-3-5-15-25(23-13-9-7-10-14-23)19-21-26(22-20-25,16-6-4-2)27(24(28)29)17-11-8-12-18-27/h23H,3-22H2,1-2H3,(H,28,29) |
| InChIKey | DFCVFQPONLRYTL-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid (CID 18607513) is 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid is CCCCC1(C2CCCCC2)CCC(CCCC)(C2(C(=O)O)CCCCC2)CC1.
What is the InChIKey of 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid?
The InChIKey is DFCVFQPONLRYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H48O2/c1-3-5-15-25(23-13-9-7-10-14-23)19-21-26(22-20-25,16-6-4-2)27(24(28)29)17-11-8-12-18-27/h23H,3-22H2,1-2H3,(H,28,29).
What are the key properties of 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid?
1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid has a molecular weight of 404.68 g/mol, XLogP of 8.53, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dibutyl-4-cyclohexylcyclohexyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 18607513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).