C20H24O2S — CID 18607735
(Z,5S,6R)-8-phenyl-6-phenylsulfanyloct-7-ene-1,5-diol (PubChem CID 18607735) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is (Z,5S,6R)-8-phenyl-6-phenylsulfanyloct-7-ene-1,5-diol.
| Compound Name | (Z,5S,6R)-8-phenyl-6-phenylsulfanyloct-7-ene-1,5-diol |
|---|---|
| PubChem CID | 18607735 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (Z,5S,6R)-8-phenyl-6-phenylsulfanyloct-7-ene-1,5-diol |
| SMILES | OCCCC[C@H](O)[C@@H](/C=C\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C20H24O2S/c21-16-8-7-13-19(22)20(23-18-11-5-2-6-12-18)15-14-17-9-3-1-4-10-17/h1-6,9-12,14-15,19-22H,7-8,13,16H2/b15-14-/t19-,20+/m0/s1 |
| InChIKey | LWZFBNHTGBVVRB-ATGVFMLPSA-N |
| XLogP | 4.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|