C25H32O3S — CID 18607736
(Z,3R,4S)-8-(oxan-2-yloxy)-1-phenyl-3-phenylsulfanyloct-1-en-4-ol (PubChem CID 18607736) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is (Z,3R,4S)-8-(oxan-2-yloxy)-1-phenyl-3-phenylsulfanyloct-1-en-4-ol.
| Compound Name | (Z,3R,4S)-8-(oxan-2-yloxy)-1-phenyl-3-phenylsulfanyloct-1-en-4-ol |
|---|---|
| PubChem CID | 18607736 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (Z,3R,4S)-8-(oxan-2-yloxy)-1-phenyl-3-phenylsulfanyloct-1-en-4-ol |
| SMILES | O[C@@H](CCCCOC1CCCCO1)[C@@H](/C=C\c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C25H32O3S/c26-23(15-7-9-19-27-25-16-8-10-20-28-25)24(29-22-13-5-2-6-14-22)18-17-21-11-3-1-4-12-21/h1-6,11-14,17-18,23-26H,7-10,15-16,19-20H2/b18-17-/t23-,24+,25?/m0/s1 |
| InChIKey | JFZFHDRDFSIGTB-QZEZAYIASA-N |
| XLogP | 5.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|