C20H26O3 — CID 18608345
[(3R,4R)-3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate (PubChem CID 18608345) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(3R,4R)-3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate.
| Compound Name | [(3R,4R)-3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate |
|---|---|
| PubChem CID | 18608345 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(3R,4R)-3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC1[C@H](Cc2ccccc2)[C@H]2CCC1(C)C2(C)C |
| InChI | InChI=1S/C20H26O3/c1-13(21)18(22)23-17-15(12-14-8-6-5-7-9-14)16-10-11-20(17,4)19(16,2)3/h5-9,15-17H,10-12H2,1-4H3/t15-,16-,17?,20?/m1/s1 |
| InChIKey | FCRYJZYBSWHWEM-VPRUJKLYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|