C24H38O5 — CID 18608645
2-[2-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5,9-dimethyldec-8-en-1-ynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid (PubChem CID 18608645) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-[2-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5,9-dimethyldec-8-en-1-ynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5,9-dimethyldec-8-en-1-ynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 18608645 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2-[2-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5,9-dimethyldec-8-en-1-ynyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]acetic acid |
| SMILES | CC(C)=CCCC(C)C[C@@H](O)C#C[C@@H]1[C@@H]2CC(CCOCC(=O)O)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H38O5/c1-16(2)5-4-6-17(3)11-20(25)7-8-21-22-13-18(9-10-29-15-24(27)28)12-19(22)14-23(21)26/h5,17-23,25-26H,4,6,9-15H2,1-3H3,(H,27,28)/t17?,18?,19-,20+,21-,22-,23-/m1/s1 |
| InChIKey | VDUUGBJPCNEGKP-JVQSZZNMSA-N |
| XLogP | 3.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|