C30H42FNO6 — CID 18608897
[(1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-methoxy-3-methyl-2-[2-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]ethyl]butanoate (PubChem CID 18608897) has the molecular formula C30H42FNO6 and a molecular weight of 531.67 g/mol. Its IUPAC name is [(1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-methoxy-3-methyl-2-[2-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]ethyl]butanoate.
| Compound Name | [(1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-methoxy-3-methyl-2-[2-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]ethyl]butanoate |
|---|---|
| PubChem CID | 18608897 |
| Molecular Formula | C30H42FNO6 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | [(1S)-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-methoxy-3-methyl-2-[2-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]ethyl]butanoate |
| SMILES | COc1cc(CCN(C)CC[C@](OC)(C(=O)O[C@H]2CCCc3cc(F)ccc32)C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C30H42FNO6/c1-20(2)30(37-7,29(33)38-25-10-8-9-22-19-23(31)11-12-24(22)25)14-16-32(3)15-13-21-17-26(34-4)28(36-6)27(18-21)35-5/h11-12,17-20,25H,8-10,13-16H2,1-7H3/t25-,30+/m0/s1 |
| InChIKey | LNBQZKXQKUNPNT-SETSBSEESA-N |
| XLogP | 5.38 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |