About N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide
N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 18609500) has the molecular formula C18H18ClNO4S
and a molecular weight of 379.87 g/mol. Its IUPAC name is N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide |
| PubChem CID | 18609500 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)C(=O)CCl)cc1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-13-7-9-15(10-8-13)25(23,24)20-16(18(22)17(21)12-19)11-14-5-3-2-4-6-14/h2-10,16,20H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | PWTSKRNJCZOJQK-INIZCTEOSA-N |
| XLogP | 2.26 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide (CID 18609500) is N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)C(=O)CCl)cc1.
What is the InChIKey of N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide?
The InChIKey is PWTSKRNJCZOJQK-INIZCTEOSA-N. The full InChI is InChI=1S/C18H18ClNO4S/c1-13-7-9-15(10-8-13)25(23,24)20-16(18(22)17(21)12-19)11-14-5-3-2-4-6-14/h2-10,16,20H,11-12H2,1H3/t16-/m0/s1.
What are the key properties of N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide?
N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide has a molecular weight of 379.87 g/mol, XLogP of 2.26, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-5-chloro-3,4-dioxo-1-phenylpentan-2-yl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 18609500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).