About trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one
trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one (PubChem CID 18609647) has the molecular formula C10H15ClO
and a molecular weight of 186.68 g/mol. Its IUPAC name is trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one.
Molecular Properties
| Compound Name | trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one |
| PubChem CID | 18609647 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one |
| SMILES | CC(C)=C[C@@H]1[C@@H](Cl)C(=O)C1(C)C |
| InChI | InChI=1S/C10H15ClO/c1-6(2)5-7-8(11)9(12)10(7,3)4/h5,7-8H,1-4H3/t7-,8-/m1/s1 |
| InChIKey | ZOMAVUNDAPMWTK-HTQZYQBOSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one?
The IUPAC name of trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one (CID 18609647) is trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one.
What is the SMILES notation for trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one?
The canonical SMILES for trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one is CC(C)=C[C@@H]1[C@@H](Cl)C(=O)C1(C)C.
What is the InChIKey of trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one?
The InChIKey is ZOMAVUNDAPMWTK-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H15ClO/c1-6(2)5-7-8(11)9(12)10(7,3)4/h5,7-8H,1-4H3/t7-,8-/m1/s1.
What are the key properties of trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one?
trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one has a molecular weight of 186.68 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4R)-4-chloro-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclobutan-1-one is sourced from PubChem (CID 18609647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).