C23H24O4 — CID 18609748
[(1S,2R,3aR,6aS)-5-oxo-1-(phenylmethoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] benzoate (PubChem CID 18609748) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(1S,2R,3aR,6aS)-5-oxo-1-(phenylmethoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] benzoate.
| Compound Name | [(1S,2R,3aR,6aS)-5-oxo-1-(phenylmethoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] benzoate |
|---|---|
| PubChem CID | 18609748 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(1S,2R,3aR,6aS)-5-oxo-1-(phenylmethoxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] benzoate |
| SMILES | O=C1C[C@H]2C[C@@H](OC(=O)c3ccccc3)[C@H](COCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C23H24O4/c24-19-11-18-12-22(27-23(25)17-9-5-2-6-10-17)21(20(18)13-19)15-26-14-16-7-3-1-4-8-16/h1-10,18,20-22H,11-15H2/t18-,20-,21+,22+/m0/s1 |
| InChIKey | ZZNUPMFEKGVUIC-VXSCBNMQSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |