C13H28N2O2 — CID 18610396
(3S,4S)-4-amino-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide (PubChem CID 18610396) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (3S,4S)-4-amino-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide.
| Compound Name | (3S,4S)-4-amino-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide |
|---|---|
| PubChem CID | 18610396 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (3S,4S)-4-amino-3-hydroxy-6-methyl-N-(2-methylbutyl)heptanamide |
| SMILES | CCC(C)CNC(=O)C[C@H](O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-5-10(4)8-15-13(17)7-12(16)11(14)6-9(2)3/h9-12,16H,5-8,14H2,1-4H3,(H,15,17)/t10?,11-,12-/m0/s1 |
| InChIKey | GHYFICKPJUPBNI-RAMGSTBQSA-N |
| XLogP | 1.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |