C16H20O4 — CID 18610603
(3S,9S)-4,4,6,10,10,12-hexamethyl-2,8-dioxatricyclo[7.3.0.03,7]dodeca-1(12),6-diene-5,11-dione (PubChem CID 18610603) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3S,9S)-4,4,6,10,10,12-hexamethyl-2,8-dioxatricyclo[7.3.0.03,7]dodeca-1(12),6-diene-5,11-dione.
| Compound Name | (3S,9S)-4,4,6,10,10,12-hexamethyl-2,8-dioxatricyclo[7.3.0.03,7]dodeca-1(12),6-diene-5,11-dione |
|---|---|
| PubChem CID | 18610603 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3S,9S)-4,4,6,10,10,12-hexamethyl-2,8-dioxatricyclo[7.3.0.03,7]dodeca-1(12),6-diene-5,11-dione |
| SMILES | CC1=C2O[C@@H]3C(=C(C)C(=O)C3(C)C)O[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C16H20O4/c1-7-9-13(15(3,4)11(7)17)20-10-8(2)12(18)16(5,6)14(10)19-9/h13-14H,1-6H3/t13-,14-/m1/s1 |
| InChIKey | SAHXOBBCQKFCPT-ZIAGYGMSSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |