C26H34O5 — CID 18610679
7-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyphenyl)-1,3-dioxan-4-yl]heptanoic acid (PubChem CID 18610679) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 7-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyphenyl)-1,3-dioxan-4-yl]heptanoic acid.
| Compound Name | 7-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyphenyl)-1,3-dioxan-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 18610679 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 7-[(4R,5S)-2,2-dimethyl-5-(2-phenylmethoxyphenyl)-1,3-dioxan-4-yl]heptanoic acid |
| SMILES | CC1(C)OC[C@H](c2ccccc2OCc2ccccc2)[C@@H](CCCCCCC(=O)O)O1 |
| InChI | InChI=1S/C26H34O5/c1-26(2)30-19-22(24(31-26)16-8-3-4-9-17-25(27)28)21-14-10-11-15-23(21)29-18-20-12-6-5-7-13-20/h5-7,10-15,22,24H,3-4,8-9,16-19H2,1-2H3,(H,27,28)/t22-,24-/m1/s1 |
| InChIKey | HBWBNSVXHRPYDO-ISKFKSNPSA-N |
| XLogP | 5.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|