About [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate
[(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate (PubChem CID 18611201) has the molecular formula C43H42NO6P
and a molecular weight of 699.78 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate.
Molecular Properties
| Compound Name | [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate |
| PubChem CID | 18611201 |
| Molecular Formula | C43H42NO6P |
| Molecular Weight | 699.78 g/mol |
| Exact Mass | 699.27 |
| IUPAC Name | [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate |
| SMILES | O=P(O)(OCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)O[C@@H](CO)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H42NO6P/c45-33-41(34-48-43(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40)50-51(46,47)49-32-31-44-42(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37/h1-30,41,44-45H,31-34H2,(H,46,47)/t41-/m0/s1 |
| InChIKey | OPRCHOWTMZFKCN-RWYGWLOXSA-N |
| XLogP | 8.07 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 699.78 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate?
The IUPAC name of [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate (CID 18611201) is [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate.
What is the SMILES notation for [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate?
The canonical SMILES for [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate is O=P(O)(OCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)O[C@@H](CO)COC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate?
The InChIKey is OPRCHOWTMZFKCN-RWYGWLOXSA-N. The full InChI is InChI=1S/C43H42NO6P/c45-33-41(34-48-43(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40)50-51(46,47)49-32-31-44-42(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37/h1-30,41,44-45H,31-34H2,(H,46,47)/t41-/m0/s1.
What are the key properties of [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate?
[(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate has a molecular weight of 699.78 g/mol, XLogP of 8.07, 17 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-hydroxy-3-trityloxypropan-2-yl] 2-(tritylamino)ethyl hydrogen phosphate is sourced from PubChem (CID 18611201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).