C19H36S2 — CID 18611740
5-methyl-2-(4-pentylcyclohexyl)-5-propyl-1,3-dithiane (PubChem CID 18611740) has the molecular formula C19H36S2 and a molecular weight of 328.63 g/mol. Its IUPAC name is 5-methyl-2-(4-pentylcyclohexyl)-5-propyl-1,3-dithiane.
| Compound Name | 5-methyl-2-(4-pentylcyclohexyl)-5-propyl-1,3-dithiane |
|---|---|
| PubChem CID | 18611740 |
| Molecular Formula | C19H36S2 |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 5-methyl-2-(4-pentylcyclohexyl)-5-propyl-1,3-dithiane |
| SMILES | CCCCCC1CCC(C2SCC(C)(CCC)CS2)CC1 |
| InChI | InChI=1S/C19H36S2/c1-4-6-7-8-16-9-11-17(12-10-16)18-20-14-19(3,13-5-2)15-21-18/h16-18H,4-15H2,1-3H3 |
| InChIKey | GJFJSYSPQFPCGB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|