About 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile
5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile (PubChem CID 18611784) has the molecular formula C23H39NO2
and a molecular weight of 361.57 g/mol. Its IUPAC name is 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile.
Molecular Properties
| Compound Name | 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile |
| PubChem CID | 18611784 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile |
| SMILES | CCCC1CCC(C2CCC(C3OCC(C#N)(CCC)CO3)CC2)CC1 |
| InChI | InChI=1S/C23H39NO2/c1-3-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-25-16-23(15-24,14-4-2)17-26-22/h18-22H,3-14,16-17H2,1-2H3 |
| InChIKey | OCHHPUZSMJXWLR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile?
The IUPAC name of 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile (CID 18611784) is 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile.
What is the SMILES notation for 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile?
The canonical SMILES for 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile is CCCC1CCC(C2CCC(C3OCC(C#N)(CCC)CO3)CC2)CC1.
What is the InChIKey of 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile?
The InChIKey is OCHHPUZSMJXWLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H39NO2/c1-3-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-25-16-23(15-24,14-4-2)17-26-22/h18-22H,3-14,16-17H2,1-2H3.
What are the key properties of 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile?
5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile has a molecular weight of 361.57 g/mol, XLogP of 6.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-2-[4-(4-propylcyclohexyl)cyclohexyl]-1,3-dioxane-5-carbonitrile is sourced from PubChem (CID 18611784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).