About azane;3-butyl-3-chloropyrrolidine-2,5-dione
azane;3-butyl-3-chloropyrrolidine-2,5-dione (PubChem CID 18612356) has the molecular formula C8H15ClN2O2
and a molecular weight of 206.67 g/mol. Its IUPAC name is azane;3-butyl-3-chloropyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | azane;3-butyl-3-chloropyrrolidine-2,5-dione |
| PubChem CID | 18612356 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | azane;3-butyl-3-chloropyrrolidine-2,5-dione |
| SMILES | CCCCC1(Cl)CC(=O)NC1=O.N |
| InChI | InChI=1S/C8H12ClNO2.H3N/c1-2-3-4-8(9)5-6(11)10-7(8)12;/h2-5H2,1H3,(H,10,11,12);1H3 |
| InChIKey | AFRHBPXCRDQYPM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze azane;3-butyl-3-chloropyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-butyl-3-chloropyrrolidine-2,5-dione?
The IUPAC name of azane;3-butyl-3-chloropyrrolidine-2,5-dione (CID 18612356) is azane;3-butyl-3-chloropyrrolidine-2,5-dione.
What is the SMILES notation for azane;3-butyl-3-chloropyrrolidine-2,5-dione?
The canonical SMILES for azane;3-butyl-3-chloropyrrolidine-2,5-dione is CCCCC1(Cl)CC(=O)NC1=O.N.
What is the InChIKey of azane;3-butyl-3-chloropyrrolidine-2,5-dione?
The InChIKey is AFRHBPXCRDQYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO2.H3N/c1-2-3-4-8(9)5-6(11)10-7(8)12;/h2-5H2,1H3,(H,10,11,12);1H3.
What are the key properties of azane;3-butyl-3-chloropyrrolidine-2,5-dione?
azane;3-butyl-3-chloropyrrolidine-2,5-dione has a molecular weight of 206.67 g/mol, XLogP of 1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-butyl-3-chloropyrrolidine-2,5-dione is sourced from PubChem (CID 18612356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).