About 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide
1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide (PubChem CID 18613655) has the molecular formula C22H29BrN2
and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide |
| PubChem CID | 18613655 |
| Molecular Formula | C22H29BrN2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide |
| SMILES | Br.Cc1ccc(N2CCN(CC3CC3c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H28N2.BrH/c1-17-8-9-22(18(2)14-17)24-12-10-23(11-13-24)16-20-15-21(20)19-6-4-3-5-7-19;/h3-9,14,20-21H,10-13,15-16H2,1-2H3;1H |
| InChIKey | LIGKFDFMSKBNRX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide?
The IUPAC name of 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide (CID 18613655) is 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide?
The canonical SMILES for 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide is Br.Cc1ccc(N2CCN(CC3CC3c3ccccc3)CC2)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide?
The InChIKey is LIGKFDFMSKBNRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2.BrH/c1-17-8-9-22(18(2)14-17)24-12-10-23(11-13-24)16-20-15-21(20)19-6-4-3-5-7-19;/h3-9,14,20-21H,10-13,15-16H2,1-2H3;1H.
What are the key properties of 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide?
1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide has a molecular weight of 401.39 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-4-[(2-phenylcyclopropyl)methyl]piperazine;hydrobromide is sourced from PubChem (CID 18613655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).