About 6-amino-1-propyl-1,3-diazinane-2,5-dione
6-amino-1-propyl-1,3-diazinane-2,5-dione (PubChem CID 18613713) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6-amino-1-propyl-1,3-diazinane-2,5-dione.
Molecular Properties
| Compound Name | 6-amino-1-propyl-1,3-diazinane-2,5-dione |
| PubChem CID | 18613713 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 6-amino-1-propyl-1,3-diazinane-2,5-dione |
| SMILES | CCCN1C(=O)NCC(=O)C1N |
| InChI | InChI=1S/C7H13N3O2/c1-2-3-10-6(8)5(11)4-9-7(10)12/h6H,2-4,8H2,1H3,(H,9,12) |
| InChIKey | HGTUCJJEZBHDFF-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1-propyl-1,3-diazinane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-propyl-1,3-diazinane-2,5-dione?
The IUPAC name of 6-amino-1-propyl-1,3-diazinane-2,5-dione (CID 18613713) is 6-amino-1-propyl-1,3-diazinane-2,5-dione.
What is the SMILES notation for 6-amino-1-propyl-1,3-diazinane-2,5-dione?
The canonical SMILES for 6-amino-1-propyl-1,3-diazinane-2,5-dione is CCCN1C(=O)NCC(=O)C1N.
What is the InChIKey of 6-amino-1-propyl-1,3-diazinane-2,5-dione?
The InChIKey is HGTUCJJEZBHDFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-2-3-10-6(8)5(11)4-9-7(10)12/h6H,2-4,8H2,1H3,(H,9,12).
What are the key properties of 6-amino-1-propyl-1,3-diazinane-2,5-dione?
6-amino-1-propyl-1,3-diazinane-2,5-dione has a molecular weight of 171.20 g/mol, XLogP of -0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-propyl-1,3-diazinane-2,5-dione is sourced from PubChem (CID 18613713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).