About 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid
4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid (PubChem CID 18613821) has the molecular formula C18H9F6NO3
and a molecular weight of 401.26 g/mol. Its IUPAC name is 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid |
| PubChem CID | 18613821 |
| Molecular Formula | C18H9F6NO3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)co2)cc1 |
| InChI | InChI=1S/C18H9F6NO3/c19-17(20,21)12-5-11(6-13(7-12)18(22,23)24)14-8-28-15(25-14)9-1-3-10(4-2-9)16(26)27/h1-8H,(H,26,27) |
| InChIKey | FRKDRQPJSAXVKM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid?
The IUPAC name of 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid (CID 18613821) is 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid.
What is the SMILES notation for 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid?
The canonical SMILES for 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid is O=C(O)c1ccc(-c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)co2)cc1.
What is the InChIKey of 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid?
The InChIKey is FRKDRQPJSAXVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F6NO3/c19-17(20,21)12-5-11(6-13(7-12)18(22,23)24)14-8-28-15(25-14)9-1-3-10(4-2-9)16(26)27/h1-8H,(H,26,27).
What are the key properties of 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid?
4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid has a molecular weight of 401.26 g/mol, XLogP of 5.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]benzoic acid is sourced from PubChem (CID 18613821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).