C17H10F3NO3 — CID 18613889
4-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-oxazol-4-yl]benzoic acid (PubChem CID 18613889) has the molecular formula C17H10F3NO3 and a molecular weight of 333.27 g/mol. Its IUPAC name is 4-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-oxazol-4-yl]benzoic acid.
| Compound Name | 4-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-oxazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 18613889 |
| Molecular Formula | C17H10F3NO3 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-oxazol-4-yl]benzoic acid |
| SMILES | Cc1c(F)cc(-c2nc(-c3ccc(C(=O)O)cc3)co2)c(F)c1F |
| InChI | InChI=1S/C17H10F3NO3/c1-8-12(18)6-11(15(20)14(8)19)16-21-13(7-24-16)9-2-4-10(5-3-9)17(22)23/h2-7H,1H3,(H,22,23) |
| InChIKey | RNIZKDVKXIXDFW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|