About N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide
N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide (PubChem CID 18614159) has the molecular formula C16H11Cl2N3O3
and a molecular weight of 364.19 g/mol. Its IUPAC name is N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide.
Molecular Properties
| Compound Name | N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide |
| PubChem CID | 18614159 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide |
| SMILES | NC(=O)C(=O)Nc1cc(Cl)c(Oc2ccc3[nH]ccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c17-11-6-9(21-16(23)15(19)22)7-12(18)14(11)24-10-1-2-13-8(5-10)3-4-20-13/h1-7,20H,(H2,19,22)(H,21,23) |
| InChIKey | WNMWOWBAZXPZIY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide?
The IUPAC name of N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide (CID 18614159) is N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide.
What is the SMILES notation for N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide?
The canonical SMILES for N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide is NC(=O)C(=O)Nc1cc(Cl)c(Oc2ccc3[nH]ccc3c2)c(Cl)c1.
What is the InChIKey of N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide?
The InChIKey is WNMWOWBAZXPZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N3O3/c17-11-6-9(21-16(23)15(19)22)7-12(18)14(11)24-10-1-2-13-8(5-10)3-4-20-13/h1-7,20H,(H2,19,22)(H,21,23).
What are the key properties of N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide?
N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide has a molecular weight of 364.19 g/mol, XLogP of 3.69, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3,5-dichloro-4-(1H-indol-5-yloxy)phenyl]oxamide is sourced from PubChem (CID 18614159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).