C24H28N2O6 — CID 18614280
2-[4-[3-(3,3-dimethylpiperidine-1-carbonyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid (PubChem CID 18614280) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[4-[3-(3,3-dimethylpiperidine-1-carbonyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid.
| Compound Name | 2-[4-[3-(3,3-dimethylpiperidine-1-carbonyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614280 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[4-[3-(3,3-dimethylpiperidine-1-carbonyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)cc(C)c1Oc1ccc(O)c(C(=O)N2CCCC(C)(C)C2)c1 |
| InChI | InChI=1S/C24H28N2O6/c1-14-10-16(25-21(28)23(30)31)11-15(2)20(14)32-17-6-7-19(27)18(12-17)22(29)26-9-5-8-24(3,4)13-26/h6-7,10-12,27H,5,8-9,13H2,1-4H3,(H,25,28)(H,30,31) |
| InChIKey | LVOWXOCSVOFOHM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|