About methyl 2-piperidin-4-ylbenzoate;hydrochloride
methyl 2-piperidin-4-ylbenzoate;hydrochloride (PubChem CID 18614359) has the molecular formula C13H18ClNO2
and a molecular weight of 255.74 g/mol. Its IUPAC name is methyl 2-piperidin-4-ylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-piperidin-4-ylbenzoate;hydrochloride |
| PubChem CID | 18614359 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl 2-piperidin-4-ylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1C1CCNCC1.Cl |
| InChI | InChI=1S/C13H17NO2.ClH/c1-16-13(15)12-5-3-2-4-11(12)10-6-8-14-9-7-10;/h2-5,10,14H,6-9H2,1H3;1H |
| InChIKey | OXRISMDMYBOCLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-piperidin-4-ylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-piperidin-4-ylbenzoate;hydrochloride?
The IUPAC name of methyl 2-piperidin-4-ylbenzoate;hydrochloride (CID 18614359) is methyl 2-piperidin-4-ylbenzoate;hydrochloride.
What is the SMILES notation for methyl 2-piperidin-4-ylbenzoate;hydrochloride?
The canonical SMILES for methyl 2-piperidin-4-ylbenzoate;hydrochloride is COC(=O)c1ccccc1C1CCNCC1.Cl.
What is the InChIKey of methyl 2-piperidin-4-ylbenzoate;hydrochloride?
The InChIKey is OXRISMDMYBOCLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.ClH/c1-16-13(15)12-5-3-2-4-11(12)10-6-8-14-9-7-10;/h2-5,10,14H,6-9H2,1H3;1H.
What are the key properties of methyl 2-piperidin-4-ylbenzoate;hydrochloride?
methyl 2-piperidin-4-ylbenzoate;hydrochloride has a molecular weight of 255.74 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-piperidin-4-ylbenzoate;hydrochloride is sourced from PubChem (CID 18614359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).