C15H9F3IN3O2 — CID 18614614
5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 18614614) has the molecular formula C15H9F3IN3O2 and a molecular weight of 447.15 g/mol. Its IUPAC name is 5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 18614614 |
| Molecular Formula | C15H9F3IN3O2 |
| Molecular Weight | 447.15 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | 5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | Cc1cc(I)ccc1Nc1c(-c2n[nH]c(=O)o2)cc(F)c(F)c1F |
| InChI | InChI=1S/C15H9F3IN3O2/c1-6-4-7(19)2-3-10(6)20-13-8(14-21-22-15(23)24-14)5-9(16)11(17)12(13)18/h2-5,20H,1H3,(H,22,23) |
| InChIKey | GORCZIPKZLSMHH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.15 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|