C15H10F3IN4S — CID 18614678
5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 18614678) has the molecular formula C15H10F3IN4S and a molecular weight of 462.24 g/mol. Its IUPAC name is 5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 18614678 |
| Molecular Formula | C15H10F3IN4S |
| Molecular Weight | 462.24 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 5-[3,4,5-trifluoro-2-(4-iodo-2-methylanilino)phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cc(I)ccc1Nc1c(-c2nnc(N)s2)cc(F)c(F)c1F |
| InChI | InChI=1S/C15H10F3IN4S/c1-6-4-7(19)2-3-10(6)21-13-8(14-22-23-15(20)24-14)5-9(16)11(17)12(13)18/h2-5,21H,1H3,(H2,20,23) |
| InChIKey | VUEDPIOQVJPKKV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|