About 1-chloropentan-1-ol
1-chloropentan-1-ol (PubChem CID 18614894) has the molecular formula C5H11ClO
and a molecular weight of 122.59 g/mol. Its IUPAC name is 1-chloropentan-1-ol.
Molecular Properties
| Compound Name | 1-chloropentan-1-ol |
| PubChem CID | 18614894 |
| Molecular Formula | C5H11ClO |
| Molecular Weight | 122.59 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 1-chloropentan-1-ol |
| SMILES | CCCCC(O)Cl |
| InChI | InChI=1S/C5H11ClO/c1-2-3-4-5(6)7/h5,7H,2-4H2,1H3 |
| InChIKey | ZZZXZQQRTBBNHT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentan-1-ol?
The IUPAC name of 1-chloropentan-1-ol (CID 18614894) is 1-chloropentan-1-ol.
What is the SMILES notation for 1-chloropentan-1-ol?
The canonical SMILES for 1-chloropentan-1-ol is CCCCC(O)Cl.
What is the InChIKey of 1-chloropentan-1-ol?
The InChIKey is ZZZXZQQRTBBNHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO/c1-2-3-4-5(6)7/h5,7H,2-4H2,1H3.
What are the key properties of 1-chloropentan-1-ol?
1-chloropentan-1-ol has a molecular weight of 122.59 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentan-1-ol is sourced from PubChem (CID 18614894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).