About 4a,10a-dihydroxanthen-4-one
4a,10a-dihydroxanthen-4-one (PubChem CID 18614999) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4a,10a-dihydroxanthen-4-one.
Molecular Properties
| Compound Name | 4a,10a-dihydroxanthen-4-one |
| PubChem CID | 18614999 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 4a,10a-dihydroxanthen-4-one |
| SMILES | O=C1C=CC=C2C=C3C=CC=CC3OC12 |
| InChI | InChI=1S/C13H10O2/c14-11-6-3-5-10-8-9-4-1-2-7-12(9)15-13(10)11/h1-8,12-13H |
| InChIKey | OUJCZJHIYLALJA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4a,10a-dihydroxanthen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,10a-dihydroxanthen-4-one?
The IUPAC name of 4a,10a-dihydroxanthen-4-one (CID 18614999) is 4a,10a-dihydroxanthen-4-one.
What is the SMILES notation for 4a,10a-dihydroxanthen-4-one?
The canonical SMILES for 4a,10a-dihydroxanthen-4-one is O=C1C=CC=C2C=C3C=CC=CC3OC12.
What is the InChIKey of 4a,10a-dihydroxanthen-4-one?
The InChIKey is OUJCZJHIYLALJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-11-6-3-5-10-8-9-4-1-2-7-12(9)15-13(10)11/h1-8,12-13H.
What are the key properties of 4a,10a-dihydroxanthen-4-one?
4a,10a-dihydroxanthen-4-one has a molecular weight of 198.22 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,10a-dihydroxanthen-4-one is sourced from PubChem (CID 18614999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).