About 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate
2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 18615279) has the molecular formula C12H18O7
and a molecular weight of 274.27 g/mol. Its IUPAC name is 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| PubChem CID | 18615279 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C7H10O5.C5H8O2/c1-4(2)6(10)12-7(11)5(9)3-8;1-4(2)5(6)7-3/h5,8-9H,1,3H2,2H3;1H2,2-3H3 |
| InChIKey | AWTSOWAVRBZADF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
The IUPAC name of 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (CID 18615279) is 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
What is the SMILES notation for 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
The canonical SMILES for 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(C)C(=O)OC(=O)C(O)CO.
What is the InChIKey of 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
The InChIKey is AWTSOWAVRBZADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5.C5H8O2/c1-4(2)6(10)12-7(11)5(9)3-8;1-4(2)5(6)7-3/h5,8-9H,1,3H2,2H3;1H2,2-3H3.
What are the key properties of 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate has a molecular weight of 274.27 g/mol, XLogP of -0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropanoyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 18615279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).