C28H26O2 — CID 18615291
1,1-bis(3-methylphenyl)-2,2-diphenylethane-1,2-diol (PubChem CID 18615291) has the molecular formula C28H26O2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1,1-bis(3-methylphenyl)-2,2-diphenylethane-1,2-diol.
| Compound Name | 1,1-bis(3-methylphenyl)-2,2-diphenylethane-1,2-diol |
|---|---|
| PubChem CID | 18615291 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1,1-bis(3-methylphenyl)-2,2-diphenylethane-1,2-diol |
| SMILES | Cc1cccc(C(O)(c2cccc(C)c2)C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H26O2/c1-21-11-9-17-25(19-21)28(30,26-18-10-12-22(2)20-26)27(29,23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-20,29-30H,1-2H3 |
| InChIKey | JORQGTJZHBZEHD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |