About 1-(methylamino)propane-1,3-dithiol
1-(methylamino)propane-1,3-dithiol (PubChem CID 18616011) has the molecular formula C4H11NS2
and a molecular weight of 137.27 g/mol. Its IUPAC name is 1-(methylamino)propane-1,3-dithiol.
Molecular Properties
| Compound Name | 1-(methylamino)propane-1,3-dithiol |
| PubChem CID | 18616011 |
| Molecular Formula | C4H11NS2 |
| Molecular Weight | 137.27 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 1-(methylamino)propane-1,3-dithiol |
| SMILES | CNC(S)CCS |
| InChI | InChI=1S/C4H11NS2/c1-5-4(7)2-3-6/h4-7H,2-3H2,1H3 |
| InChIKey | RTSAAMOUUFBQIN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylamino)propane-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)propane-1,3-dithiol?
The IUPAC name of 1-(methylamino)propane-1,3-dithiol (CID 18616011) is 1-(methylamino)propane-1,3-dithiol.
What is the SMILES notation for 1-(methylamino)propane-1,3-dithiol?
The canonical SMILES for 1-(methylamino)propane-1,3-dithiol is CNC(S)CCS.
What is the InChIKey of 1-(methylamino)propane-1,3-dithiol?
The InChIKey is RTSAAMOUUFBQIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NS2/c1-5-4(7)2-3-6/h4-7H,2-3H2,1H3.
What are the key properties of 1-(methylamino)propane-1,3-dithiol?
1-(methylamino)propane-1,3-dithiol has a molecular weight of 137.27 g/mol, XLogP of 0.78, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)propane-1,3-dithiol is sourced from PubChem (CID 18616011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).