About [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate
[1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate (PubChem CID 18616054) has the molecular formula C20H15N3O3S
and a molecular weight of 377.43 g/mol. Its IUPAC name is [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate.
Molecular Properties
| Compound Name | [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate |
| PubChem CID | 18616054 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate |
| SMILES | Cc1c(C(=O)c2cnn(C)c2OC(=O)c2ccccc2)ccc2scnc12 |
| InChI | InChI=1S/C20H15N3O3S/c1-12-14(8-9-16-17(12)21-11-27-16)18(24)15-10-22-23(2)19(15)26-20(25)13-6-4-3-5-7-13/h3-11H,1-2H3 |
| InChIKey | VTCKKOSAGIXGGD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate?
The IUPAC name of [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate (CID 18616054) is [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate.
What is the SMILES notation for [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate?
The canonical SMILES for [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate is Cc1c(C(=O)c2cnn(C)c2OC(=O)c2ccccc2)ccc2scnc12.
What is the InChIKey of [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate?
The InChIKey is VTCKKOSAGIXGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O3S/c1-12-14(8-9-16-17(12)21-11-27-16)18(24)15-10-22-23(2)19(15)26-20(25)13-6-4-3-5-7-13/h3-11H,1-2H3.
What are the key properties of [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate?
[1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate has a molecular weight of 377.43 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-4-(4-methyl-1,3-benzothiazole-5-carbonyl)pyrazol-5-yl] benzoate is sourced from PubChem (CID 18616054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).