About 9a,10-dihydro-1H-acridin-9-one
9a,10-dihydro-1H-acridin-9-one (PubChem CID 18616822) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 9a,10-dihydro-1H-acridin-9-one.
Molecular Properties
| Compound Name | 9a,10-dihydro-1H-acridin-9-one |
| PubChem CID | 18616822 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 9a,10-dihydro-1H-acridin-9-one |
| SMILES | O=C1c2ccccc2NC2=CC=CCC12 |
| InChI | InChI=1S/C13H11NO/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h1-5,7-8,10,14H,6H2 |
| InChIKey | RIBVZWMAACMTNK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9a,10-dihydro-1H-acridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9a,10-dihydro-1H-acridin-9-one?
The IUPAC name of 9a,10-dihydro-1H-acridin-9-one (CID 18616822) is 9a,10-dihydro-1H-acridin-9-one.
What is the SMILES notation for 9a,10-dihydro-1H-acridin-9-one?
The canonical SMILES for 9a,10-dihydro-1H-acridin-9-one is O=C1c2ccccc2NC2=CC=CCC12.
What is the InChIKey of 9a,10-dihydro-1H-acridin-9-one?
The InChIKey is RIBVZWMAACMTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h1-5,7-8,10,14H,6H2.
What are the key properties of 9a,10-dihydro-1H-acridin-9-one?
9a,10-dihydro-1H-acridin-9-one has a molecular weight of 197.24 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9a,10-dihydro-1H-acridin-9-one is sourced from PubChem (CID 18616822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).