4-furo[3,2-c]pyridin-2-ylbenzoic acid

C14H9NO3 — CID 18617783

IUPAC4-furo[3,2-c]pyridin-2-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2cc3cnccc3o2)cc1
InChIInChI=1S/C14H9NO3/c16-14(17)10-3-1-9(2-4-10)13-7-11-8-15-6-5-12(11)18-13/h1-8H,(H,16,17)
InChIKeyABLKDMZDSKBYOO-UHFFFAOYSA-N
MW239.23 g/mol
LogP3.19
Rot. Bonds2

About 4-furo[3,2-c]pyridin-2-ylbenzoic acid

4-furo[3,2-c]pyridin-2-ylbenzoic acid (PubChem CID 18617783) has the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-furo[3,2-c]pyridin-2-ylbenzoic acid.

Molecular Properties

Compound Name4-furo[3,2-c]pyridin-2-ylbenzoic acid
PubChem CID18617783
Molecular FormulaC14H9NO3
Molecular Weight239.23 g/mol
Exact Mass239.06
IUPAC Name4-furo[3,2-c]pyridin-2-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2cc3cnccc3o2)cc1
InChIInChI=1S/C14H9NO3/c16-14(17)10-3-1-9(2-4-10)13-7-11-8-15-6-5-12(11)18-13/h1-8H,(H,16,17)
InChIKeyABLKDMZDSKBYOO-UHFFFAOYSA-N
XLogP3.19
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.23
LogP ≤ 53.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-furo[3,2-c]pyridin-2-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-furo[3,2-c]pyridin-2-ylbenzoic acid?
The IUPAC name of 4-furo[3,2-c]pyridin-2-ylbenzoic acid (CID 18617783) is 4-furo[3,2-c]pyridin-2-ylbenzoic acid.
What is the SMILES notation for 4-furo[3,2-c]pyridin-2-ylbenzoic acid?
The canonical SMILES for 4-furo[3,2-c]pyridin-2-ylbenzoic acid is O=C(O)c1ccc(-c2cc3cnccc3o2)cc1.
What is the InChIKey of 4-furo[3,2-c]pyridin-2-ylbenzoic acid?
The InChIKey is ABLKDMZDSKBYOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO3/c16-14(17)10-3-1-9(2-4-10)13-7-11-8-15-6-5-12(11)18-13/h1-8H,(H,16,17).
What are the key properties of 4-furo[3,2-c]pyridin-2-ylbenzoic acid?
4-furo[3,2-c]pyridin-2-ylbenzoic acid has a molecular weight of 239.23 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-furo[3,2-c]pyridin-2-ylbenzoic acid is sourced from PubChem (CID 18617783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).