diethyl 3-(3,3,3-trifluoropropyl)pentanedioate

C12H19F3O4 — CID 18618096

IUPACdiethyl 3-(3,3,3-trifluoropropyl)pentanedioate
SMILESCCOC(=O)CC(CCC(F)(F)F)CC(=O)OCC
InChIInChI=1S/C12H19F3O4/c1-3-18-10(16)7-9(5-6-12(13,14)15)8-11(17)19-4-2/h9H,3-8H2,1-2H3
InChIKeyZYGHIHZXDXJIMD-UHFFFAOYSA-N
MW284.27 g/mol
LogP2.85
Rot. Bonds8

About diethyl 3-(3,3,3-trifluoropropyl)pentanedioate

diethyl 3-(3,3,3-trifluoropropyl)pentanedioate (PubChem CID 18618096) has the molecular formula C12H19F3O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is diethyl 3-(3,3,3-trifluoropropyl)pentanedioate.

Molecular Properties

Compound Namediethyl 3-(3,3,3-trifluoropropyl)pentanedioate
PubChem CID18618096
Molecular FormulaC12H19F3O4
Molecular Weight284.27 g/mol
Exact Mass284.12
IUPAC Namediethyl 3-(3,3,3-trifluoropropyl)pentanedioate
SMILESCCOC(=O)CC(CCC(F)(F)F)CC(=O)OCC
InChIInChI=1S/C12H19F3O4/c1-3-18-10(16)7-9(5-6-12(13,14)15)8-11(17)19-4-2/h9H,3-8H2,1-2H3
InChIKeyZYGHIHZXDXJIMD-UHFFFAOYSA-N
XLogP2.85
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.27
LogP ≤ 52.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze diethyl 3-(3,3,3-trifluoropropyl)pentanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 3-(3,3,3-trifluoropropyl)pentanedioate?
The IUPAC name of diethyl 3-(3,3,3-trifluoropropyl)pentanedioate (CID 18618096) is diethyl 3-(3,3,3-trifluoropropyl)pentanedioate.
What is the SMILES notation for diethyl 3-(3,3,3-trifluoropropyl)pentanedioate?
The canonical SMILES for diethyl 3-(3,3,3-trifluoropropyl)pentanedioate is CCOC(=O)CC(CCC(F)(F)F)CC(=O)OCC.
What is the InChIKey of diethyl 3-(3,3,3-trifluoropropyl)pentanedioate?
The InChIKey is ZYGHIHZXDXJIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O4/c1-3-18-10(16)7-9(5-6-12(13,14)15)8-11(17)19-4-2/h9H,3-8H2,1-2H3.
What are the key properties of diethyl 3-(3,3,3-trifluoropropyl)pentanedioate?
diethyl 3-(3,3,3-trifluoropropyl)pentanedioate has a molecular weight of 284.27 g/mol, XLogP of 2.85, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-(3,3,3-trifluoropropyl)pentanedioate is sourced from PubChem (CID 18618096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).