About 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine
1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine (PubChem CID 18618172) has the molecular formula C9H24N4
and a molecular weight of 188.32 g/mol. Its IUPAC name is 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine |
| PubChem CID | 18618172 |
| Molecular Formula | C9H24N4 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.20 |
| IUPAC Name | 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine |
| SMILES | CC(N)CN(CC(C)N)CC(C)N |
| InChI | InChI=1S/C9H24N4/c1-7(10)4-13(5-8(2)11)6-9(3)12/h7-9H,4-6,10-12H2,1-3H3 |
| InChIKey | WUEHOBBABKCBHF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine?
The IUPAC name of 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine (CID 18618172) is 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine.
What is the SMILES notation for 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine?
The canonical SMILES for 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine is CC(N)CN(CC(C)N)CC(C)N.
What is the InChIKey of 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine?
The InChIKey is WUEHOBBABKCBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24N4/c1-7(10)4-13(5-8(2)11)6-9(3)12/h7-9H,4-6,10-12H2,1-3H3.
What are the key properties of 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine?
1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine has a molecular weight of 188.32 g/mol, XLogP of -0.67, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-bis(2-aminopropyl)propane-1,2-diamine is sourced from PubChem (CID 18618172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).