About ethoxyethane;4-methylheptan-1-amine
ethoxyethane;4-methylheptan-1-amine (PubChem CID 18618987) has the molecular formula C12H29NO
and a molecular weight of 203.37 g/mol. Its IUPAC name is ethoxyethane;4-methylheptan-1-amine.
Molecular Properties
| Compound Name | ethoxyethane;4-methylheptan-1-amine |
| PubChem CID | 18618987 |
| Molecular Formula | C12H29NO |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | ethoxyethane;4-methylheptan-1-amine |
| SMILES | CCCC(C)CCCN.CCOCC |
| InChI | InChI=1S/C8H19N.C4H10O/c1-3-5-8(2)6-4-7-9;1-3-5-4-2/h8H,3-7,9H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | LLPIYIUUYPNMCK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethoxyethane;4-methylheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;4-methylheptan-1-amine?
The IUPAC name of ethoxyethane;4-methylheptan-1-amine (CID 18618987) is ethoxyethane;4-methylheptan-1-amine.
What is the SMILES notation for ethoxyethane;4-methylheptan-1-amine?
The canonical SMILES for ethoxyethane;4-methylheptan-1-amine is CCCC(C)CCCN.CCOCC.
What is the InChIKey of ethoxyethane;4-methylheptan-1-amine?
The InChIKey is LLPIYIUUYPNMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C4H10O/c1-3-5-8(2)6-4-7-9;1-3-5-4-2/h8H,3-7,9H2,1-2H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;4-methylheptan-1-amine?
ethoxyethane;4-methylheptan-1-amine has a molecular weight of 203.37 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;4-methylheptan-1-amine is sourced from PubChem (CID 18618987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).