C6H8I6 — CID 18619067
1,1,2,3,4,6-hexaiodohexane (PubChem CID 18619067) has the molecular formula C6H8I6 and a molecular weight of 841.55 g/mol. Its IUPAC name is 1,1,2,3,4,6-hexaiodohexane.
| Compound Name | 1,1,2,3,4,6-hexaiodohexane |
|---|---|
| PubChem CID | 18619067 |
| Molecular Formula | C6H8I6 |
| Molecular Weight | 841.55 g/mol |
| Exact Mass | 841.49 |
| IUPAC Name | 1,1,2,3,4,6-hexaiodohexane |
| SMILES | ICCC(I)C(I)C(I)C(I)I |
| InChI | InChI=1S/C6H8I6/c7-2-1-3(8)4(9)5(10)6(11)12/h3-6H,1-2H2 |
| InChIKey | CLXZZJGVUPFWOW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|