C13H26N2 — CID 18619904
N,2,2,6,6-pentamethyl-N-prop-2-enylpiperidin-4-amine (PubChem CID 18619904) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N,2,2,6,6-pentamethyl-N-prop-2-enylpiperidin-4-amine.
| Compound Name | N,2,2,6,6-pentamethyl-N-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 18619904 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N,2,2,6,6-pentamethyl-N-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H26N2/c1-7-8-15(6)11-9-12(2,3)14-13(4,5)10-11/h7,11,14H,1,8-10H2,2-6H3 |
| InChIKey | HTOCUEIDXVYZAO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|