C34H64N8 — CID 18619905
2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-N-prop-2-enyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 18619905) has the molecular formula C34H64N8 and a molecular weight of 584.94 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-N-prop-2-enyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-N-prop-2-enyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18619905 |
| Molecular Formula | C34H64N8 |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 584.53 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-N-prop-2-enyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCNc1nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C34H64N8/c1-14-17-20-41(26-22-31(4,5)39(12)32(6,7)23-26)29-36-28(35-19-16-3)37-30(38-29)42(21-18-15-2)27-24-33(8,9)40(13)34(10,11)25-27/h16,26-27H,3,14-15,17-25H2,1-2,4-13H3,(H,35,36,37,38) |
| InChIKey | LEQJOZADOVEBCM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|