C16H32N2 — CID 18619909
N-butyl-2,2,6,6-tetramethyl-N-prop-2-enylpiperidin-4-amine (PubChem CID 18619909) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is N-butyl-2,2,6,6-tetramethyl-N-prop-2-enylpiperidin-4-amine.
| Compound Name | N-butyl-2,2,6,6-tetramethyl-N-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 18619909 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N-butyl-2,2,6,6-tetramethyl-N-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN(CCCC)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H32N2/c1-7-9-11-18(10-8-2)14-12-15(3,4)17-16(5,6)13-14/h8,14,17H,2,7,9-13H2,1,3-6H3 |
| InChIKey | LXUGZGMUJRKXOB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|