About 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane
2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 18620234) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 18620234 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC(O)CC(C)(C)O |
| InChI | InChI=1S/C6H10O3.C6H14O2/c1(5-3-8-5)7-2-6-4-9-6;1-5(7)4-6(2,3)8/h5-6H,1-4H2;5,7-8H,4H2,1-3H3 |
| InChIKey | GZAHGSJNYQZIIQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 18620234) is 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CC(O)CC(C)(C)O.
What is the InChIKey of 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is GZAHGSJNYQZIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H14O2/c1(5-3-8-5)7-2-6-4-9-6;1-5(7)4-6(2,3)8/h5-6H,1-4H2;5,7-8H,4H2,1-3H3.
What are the key properties of 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 248.32 g/mol, XLogP of 0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane-2,4-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 18620234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).