About cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one
cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one (PubChem CID 18620273) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one.
Molecular Properties
| Compound Name | cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one |
| PubChem CID | 18620273 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one |
| SMILES | CC(C)=CC(=O)C=C(C)C.O=C1CCCCC1 |
| InChI | InChI=1S/C9H14O.C6H10O/c1-7(2)5-9(10)6-8(3)4;7-6-4-2-1-3-5-6/h5-6H,1-4H3;1-5H2 |
| InChIKey | CTRPDSUXFLTYRV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one?
The IUPAC name of cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one (CID 18620273) is cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one.
What is the SMILES notation for cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one?
The canonical SMILES for cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one is CC(C)=CC(=O)C=C(C)C.O=C1CCCCC1.
What is the InChIKey of cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one?
The InChIKey is CTRPDSUXFLTYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.C6H10O/c1-7(2)5-9(10)6-8(3)4;7-6-4-2-1-3-5-6/h5-6H,1-4H3;1-5H2.
What are the key properties of cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one?
cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one has a molecular weight of 236.35 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanone;2,6-dimethylhepta-2,5-dien-4-one is sourced from PubChem (CID 18620273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).