About (E)-stilbene;2H-triazole
(E)-stilbene;2H-triazole (PubChem CID 18620499) has the molecular formula C16H15N3
and a molecular weight of 249.32 g/mol. Its IUPAC name is (E)-stilbene;2H-triazole.
Molecular Properties
| Compound Name | (E)-stilbene;2H-triazole |
| PubChem CID | 18620499 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (E)-stilbene;2H-triazole |
| SMILES | C(=C/c1ccccc1)\c1ccccc1.c1cn[nH]n1 |
| InChI | InChI=1S/C14H12.C2H3N3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-4-5-3-1/h1-12H;1-2H,(H,3,4,5)/b12-11+; |
| InChIKey | GKYQYVQDCHBZJM-CALJPSDSSA-N |
| XLogP | 3.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-stilbene;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-stilbene;2H-triazole?
The IUPAC name of (E)-stilbene;2H-triazole (CID 18620499) is (E)-stilbene;2H-triazole.
What is the SMILES notation for (E)-stilbene;2H-triazole?
The canonical SMILES for (E)-stilbene;2H-triazole is C(=C/c1ccccc1)\c1ccccc1.c1cn[nH]n1.
What is the InChIKey of (E)-stilbene;2H-triazole?
The InChIKey is GKYQYVQDCHBZJM-CALJPSDSSA-N. The full InChI is InChI=1S/C14H12.C2H3N3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-4-5-3-1/h1-12H;1-2H,(H,3,4,5)/b12-11+;.
What are the key properties of (E)-stilbene;2H-triazole?
(E)-stilbene;2H-triazole has a molecular weight of 249.32 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-stilbene;2H-triazole is sourced from PubChem (CID 18620499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).