C34H41N3O3 — CID 18621093
4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-1-[3-[(4-nitrophenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]butan-1-one (PubChem CID 18621093) has the molecular formula C34H41N3O3 and a molecular weight of 539.72 g/mol. Its IUPAC name is 4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-1-[3-[(4-nitrophenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]butan-1-one.
| Compound Name | 4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-1-[3-[(4-nitrophenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]butan-1-one |
|---|---|
| PubChem CID | 18621093 |
| Molecular Formula | C34H41N3O3 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | 4-[1-[(4-methylphenyl)methyl]piperidin-4-yl]-1-[3-[(4-nitrophenyl)methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]butan-1-one |
| SMILES | Cc1ccc(CN2CCC(CCCC(=O)c3ccc4c(c3)CCN(Cc3ccc([N+](=O)[O-])cc3)CC4)CC2)cc1 |
| InChI | InChI=1S/C34H41N3O3/c1-26-5-7-28(8-6-26)24-35-19-15-27(16-20-35)3-2-4-34(38)32-12-11-30-17-21-36(22-18-31(30)23-32)25-29-9-13-33(14-10-29)37(39)40/h5-14,23,27H,2-4,15-22,24-25H2,1H3 |
| InChIKey | OBRUHSMBAJFAMD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|